C20H32O3 — CID 134983468
(4E,12E)-8-methyl-1-(oxan-2-yloxy)tetradeca-4,9,10,12-tetraen-6-ol (PubChem CID 134983468) has the molecular formula C20H32O3 and a molecular weight of 320.47 g/mol. Its IUPAC name is (4E,12E)-8-methyl-1-(oxan-2-yloxy)tetradeca-4,9,10,12-tetraen-6-ol.
| Compound Name | (4E,12E)-8-methyl-1-(oxan-2-yloxy)tetradeca-4,9,10,12-tetraen-6-ol |
|---|---|
| PubChem CID | 134983468 |
| Molecular Formula | C20H32O3 |
| Molecular Weight | 320.47 g/mol |
| Exact Mass | 320.24 |
| IUPAC Name | (4E,12E)-8-methyl-1-(oxan-2-yloxy)tetradeca-4,9,10,12-tetraen-6-ol |
| SMILES | C/C=C/C=C=CC(C)CC(O)/C=C/CCCOC1CCCCO1 |
| InChI | InChI=1S/C20H32O3/c1-3-4-5-7-12-18(2)17-19(21)13-8-6-10-15-22-20-14-9-11-16-23-20/h3-5,8,12-13,18-21H,6,9-11,14-17H2,1-2H3/b4-3+,13-8+ |
| InChIKey | WIMXMIQCWDIPEC-JRWPLQFESA-N |
| XLogP | 4.54 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.47 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|