C19H30O3 — CID 134957086
(6S,9E)-2,10-dimethyl-3-(oxan-2-yloxy)dodeca-9,11-dien-4-yn-6-ol (PubChem CID 134957086) has the molecular formula C19H30O3 and a molecular weight of 306.45 g/mol. Its IUPAC name is (6S,9E)-2,10-dimethyl-3-(oxan-2-yloxy)dodeca-9,11-dien-4-yn-6-ol.
| Compound Name | (6S,9E)-2,10-dimethyl-3-(oxan-2-yloxy)dodeca-9,11-dien-4-yn-6-ol |
|---|---|
| PubChem CID | 134957086 |
| Molecular Formula | C19H30O3 |
| Molecular Weight | 306.45 g/mol |
| Exact Mass | 306.22 |
| IUPAC Name | (6S,9E)-2,10-dimethyl-3-(oxan-2-yloxy)dodeca-9,11-dien-4-yn-6-ol |
| SMILES | C=C/C(C)=C/CC[C@H](O)C#CC(OC1CCCCO1)C(C)C |
| InChI | InChI=1S/C19H30O3/c1-5-16(4)9-8-10-17(20)12-13-18(15(2)3)22-19-11-6-7-14-21-19/h5,9,15,17-20H,1,6-8,10-11,14H2,2-4H3/b16-9+/t17-,18?,19?/m0/s1 |
| InChIKey | OXAZSPWPDZGLIC-ZKSPPNLXSA-N |
| XLogP | 3.83 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.45 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|