C18H16O3Se — CID 139265523
(Z)-5-hydroxy-1-phenyl-2-phenylselanylhex-2-ene-1,4-dione (PubChem CID 139265523) has the molecular formula C18H16O3Se and a molecular weight of 359.28 g/mol. Its IUPAC name is (Z)-5-hydroxy-1-phenyl-2-phenylselanylhex-2-ene-1,4-dione.
| Compound Name | (Z)-5-hydroxy-1-phenyl-2-phenylselanylhex-2-ene-1,4-dione |
|---|---|
| PubChem CID | 139265523 |
| Molecular Formula | C18H16O3Se |
| Molecular Weight | 359.28 g/mol |
| Exact Mass | 360.03 |
| IUPAC Name | (Z)-5-hydroxy-1-phenyl-2-phenylselanylhex-2-ene-1,4-dione |
| SMILES | CC(O)C(=O)/C=C(\[Se]c1ccccc1)C(=O)c1ccccc1 |
| InChI | InChI=1S/C18H16O3Se/c1-13(19)16(20)12-17(22-15-10-6-3-7-11-15)18(21)14-8-4-2-5-9-14/h2-13,19H,1H3/b17-12- |
| InChIKey | AGZFKAYKNGGSTL-ATVHPVEESA-N |
| XLogP | 1.73 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.28 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|