C11H15O3STe- — CID 139265776
3-(2,6-dimethylphenyl)tellanylpropane-1-sulfonate (PubChem CID 139265776) has the molecular formula C11H15O3STe- and a molecular weight of 354.91 g/mol. Its IUPAC name is 3-(2,6-dimethylphenyl)tellanylpropane-1-sulfonate.
| Compound Name | 3-(2,6-dimethylphenyl)tellanylpropane-1-sulfonate |
|---|---|
| PubChem CID | 139265776 |
| Molecular Formula | C11H15O3STe- |
| Molecular Weight | 354.91 g/mol |
| Exact Mass | 356.98 |
| IUPAC Name | 3-(2,6-dimethylphenyl)tellanylpropane-1-sulfonate |
| SMILES | Cc1cccc(C)c1[Te]CCCS(=O)(=O)[O-] |
| InChI | InChI=1S/C11H16O3STe/c1-9-5-3-6-10(2)11(9)16-8-4-7-15(12,13)14/h3,5-6H,4,7-8H2,1-2H3,(H,12,13,14)/p-1 |
| InChIKey | QKMCFARUAUBYAF-UHFFFAOYSA-M |
| XLogP | 0.99 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.91 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|