C24H31N2O3S- — CID 101119582
6,7-bis[(2,6-dimethylphenyl)imino]octane-1-sulfonate (PubChem CID 101119582) has the molecular formula C24H31N2O3S- and a molecular weight of 427.59 g/mol. Its IUPAC name is 6,7-bis[(2,6-dimethylphenyl)imino]octane-1-sulfonate.
| Compound Name | 6,7-bis[(2,6-dimethylphenyl)imino]octane-1-sulfonate |
|---|---|
| PubChem CID | 101119582 |
| Molecular Formula | C24H31N2O3S- |
| Molecular Weight | 427.59 g/mol |
| Exact Mass | 427.21 |
| IUPAC Name | 6,7-bis[(2,6-dimethylphenyl)imino]octane-1-sulfonate |
| SMILES | CC(=N\c1c(C)cccc1C)/C(CCCCCS(=O)(=O)[O-])=N/c1c(C)cccc1C |
| InChI | InChI=1S/C24H32N2O3S/c1-17-11-9-12-18(2)23(17)25-21(5)22(15-7-6-8-16-30(27,28)29)26-24-19(3)13-10-14-20(24)4/h9-14H,6-8,15-16H2,1-5H3,(H,27,28,29)/p-1/b25-21+,26-22+ |
| InChIKey | AQYUXBHRQPMXIS-CDTUYSNOSA-M |
| XLogP | 5.89 |
| TPSA | 81.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.59 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|