C26H39BrN2NiOSi- — CID 21131773
2-N,3-N-bis(2,6-dimethylphenyl)-6-trimethylsilyloxyhexane-2,3-diimine;bromonickel;carbanide (PubChem CID 21131773) has the molecular formula C26H39BrN2NiOSi- and a molecular weight of 562.29 g/mol. Its IUPAC name is 2-N,3-N-bis(2,6-dimethylphenyl)-6-trimethylsilyloxyhexane-2,3-diimine;bromonickel;carbanide.
| Compound Name | 2-N,3-N-bis(2,6-dimethylphenyl)-6-trimethylsilyloxyhexane-2,3-diimine;bromonickel;carbanide |
|---|---|
| PubChem CID | 21131773 |
| Molecular Formula | C26H39BrN2NiOSi- |
| Molecular Weight | 562.29 g/mol |
| Exact Mass | 560.14 |
| IUPAC Name | 2-N,3-N-bis(2,6-dimethylphenyl)-6-trimethylsilyloxyhexane-2,3-diimine;bromonickel;carbanide |
| SMILES | CC(=N\c1c(C)cccc1C)/C(CCCO[Si](C)(C)C)=N/c1c(C)cccc1C.[CH3-].[Ni]Br |
| InChI | InChI=1S/C25H36N2OSi.CH3.BrH.Ni/c1-18-12-9-13-19(2)24(18)26-22(5)23(16-11-17-28-29(6,7)8)27-25-20(3)14-10-15-21(25)4;;;/h9-10,12-15H,11,16-17H2,1-8H3;1H3;1H;/q;-1;;+1/p-1/b26-22+,27-23+;;; |
| InChIKey | IFEGFVWDXHAPCV-BZQCXFOGSA-M |
| XLogP | 8.71 |
| TPSA | 33.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.29 |
| LogP ≤ 5 | 8.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|