C28H38Cl4N2Ti — CID 140632539
7-cyclopentyl-2-N,3-N-bis(2,6-dimethylphenyl)heptane-2,3-diimine;tetrachlorotitanium (PubChem CID 140632539) has the molecular formula C28H38Cl4N2Ti and a molecular weight of 592.31 g/mol. Its IUPAC name is 7-cyclopentyl-2-N,3-N-bis(2,6-dimethylphenyl)heptane-2,3-diimine;tetrachlorotitanium.
| Compound Name | 7-cyclopentyl-2-N,3-N-bis(2,6-dimethylphenyl)heptane-2,3-diimine;tetrachlorotitanium |
|---|---|
| PubChem CID | 140632539 |
| Molecular Formula | C28H38Cl4N2Ti |
| Molecular Weight | 592.31 g/mol |
| Exact Mass | 590.13 |
| IUPAC Name | 7-cyclopentyl-2-N,3-N-bis(2,6-dimethylphenyl)heptane-2,3-diimine;tetrachlorotitanium |
| SMILES | CC(=N\c1c(C)cccc1C)/C(CCCCC1CCCC1)=N/c1c(C)cccc1C.Cl[Ti](Cl)(Cl)Cl |
| InChI | InChI=1S/C28H38N2.4ClH.Ti/c1-20-12-10-13-21(2)27(20)29-24(5)26(19-9-8-18-25-16-6-7-17-25)30-28-22(3)14-11-15-23(28)4;;;;;/h10-15,25H,6-9,16-19H2,1-5H3;4*1H;/q;;;;;+4/p-4/b29-24+,30-26+;;;;; |
| InChIKey | LWHFDJYKCWXHSO-YVJGLYSESA-J |
| XLogP | 11.29 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.31 |
| LogP ≤ 5 | 11.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|