C25H34Br2N2OSi — CID 21131746
2-N,3-N-bis(4-bromo-2,6-dimethylphenyl)-6-trimethylsilyloxyhexane-2,3-diimine (PubChem CID 21131746) has the molecular formula C25H34Br2N2OSi and a molecular weight of 566.45 g/mol. Its IUPAC name is 2-N,3-N-bis(4-bromo-2,6-dimethylphenyl)-6-trimethylsilyloxyhexane-2,3-diimine.
| Compound Name | 2-N,3-N-bis(4-bromo-2,6-dimethylphenyl)-6-trimethylsilyloxyhexane-2,3-diimine |
|---|---|
| PubChem CID | 21131746 |
| Molecular Formula | C25H34Br2N2OSi |
| Molecular Weight | 566.45 g/mol |
| Exact Mass | 564.08 |
| IUPAC Name | 2-N,3-N-bis(4-bromo-2,6-dimethylphenyl)-6-trimethylsilyloxyhexane-2,3-diimine |
| SMILES | CC(=N\c1c(C)cc(Br)cc1C)/C(CCCO[Si](C)(C)C)=N/c1c(C)cc(Br)cc1C |
| InChI | InChI=1S/C25H34Br2N2OSi/c1-16-12-21(26)13-17(2)24(16)28-20(5)23(10-9-11-30-31(6,7)8)29-25-18(3)14-22(27)15-19(25)4/h12-15H,9-11H2,1-8H3/b28-20+,29-23+ |
| InChIKey | SGMPUVWKWAKMQN-NHYOMVJSSA-N |
| XLogP | 8.94 |
| TPSA | 33.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.45 |
| LogP ≤ 5 | 8.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|