C32H53Br2N3NiO2Si2 — CID 21131730
4,5-bis[(2,6-dimethylphenyl)imino]-N,N-bis(2-trimethylsilyloxyethyl)hexan-1-amine;dibromonickel (PubChem CID 21131730) has the molecular formula C32H53Br2N3NiO2Si2 and a molecular weight of 786.47 g/mol. Its IUPAC name is 4,5-bis[(2,6-dimethylphenyl)imino]-N,N-bis(2-trimethylsilyloxyethyl)hexan-1-amine;dibromonickel.
| Compound Name | 4,5-bis[(2,6-dimethylphenyl)imino]-N,N-bis(2-trimethylsilyloxyethyl)hexan-1-amine;dibromonickel |
|---|---|
| PubChem CID | 21131730 |
| Molecular Formula | C32H53Br2N3NiO2Si2 |
| Molecular Weight | 786.47 g/mol |
| Exact Mass | 783.14 |
| IUPAC Name | 4,5-bis[(2,6-dimethylphenyl)imino]-N,N-bis(2-trimethylsilyloxyethyl)hexan-1-amine;dibromonickel |
| SMILES | Br[Ni]Br.CC(=N\c1c(C)cccc1C)/C(CCCN(CCO[Si](C)(C)C)CCO[Si](C)(C)C)=N/c1c(C)cccc1C |
| InChI | InChI=1S/C32H53N3O2Si2.2BrH.Ni/c1-25-15-12-16-26(2)31(25)33-29(5)30(34-32-27(3)17-13-18-28(32)4)19-14-20-35(21-23-36-38(6,7)8)22-24-37-39(9,10)11;;;/h12-13,15-18H,14,19-24H2,1-11H3;2*1H;/q;;;+2/p-2/b33-29+,34-30+;;; |
| InChIKey | XBNTYKCDGAPZSX-OAMUHEOFSA-L |
| XLogP | 10.26 |
| TPSA | 46.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 786.47 |
| LogP ≤ 5 | 10.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|