C34H56Br2N2NiO4Si2 — CID 21131696
4-N,5-N-bis(2,6-dimethylphenyl)-1,8-bis(2-trimethylsilyloxyethoxy)octane-4,5-diimine;dibromonickel (PubChem CID 21131696) has the molecular formula C34H56Br2N2NiO4Si2 and a molecular weight of 831.50 g/mol. Its IUPAC name is 4-N,5-N-bis(2,6-dimethylphenyl)-1,8-bis(2-trimethylsilyloxyethoxy)octane-4,5-diimine;dibromonickel.
| Compound Name | 4-N,5-N-bis(2,6-dimethylphenyl)-1,8-bis(2-trimethylsilyloxyethoxy)octane-4,5-diimine;dibromonickel |
|---|---|
| PubChem CID | 21131696 |
| Molecular Formula | C34H56Br2N2NiO4Si2 |
| Molecular Weight | 831.50 g/mol |
| Exact Mass | 828.15 |
| IUPAC Name | 4-N,5-N-bis(2,6-dimethylphenyl)-1,8-bis(2-trimethylsilyloxyethoxy)octane-4,5-diimine;dibromonickel |
| SMILES | Br[Ni]Br.Cc1cccc(C)c1/N=C(CCCOCCO[Si](C)(C)C)/C(CCCOCCO[Si](C)(C)C)=N/c1c(C)cccc1C |
| InChI | InChI=1S/C34H56N2O4Si2.2BrH.Ni/c1-27-15-11-16-28(2)33(27)35-31(19-13-21-37-23-25-39-41(5,6)7)32(36-34-29(3)17-12-18-30(34)4)20-14-22-38-24-26-40-42(8,9)10;;;/h11-12,15-18H,13-14,19-26H2,1-10H3;2*1H;/q;;;+2/p-2/b35-31+,36-32+;;; |
| InChIKey | IRUHWIOBZPETAD-DDVHGCDCSA-L |
| XLogP | 10.75 |
| TPSA | 61.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 831.50 |
| LogP ≤ 5 | 10.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|