C30H48Br2N2NiO2Si2 — CID 24941636
4-N,5-N-bis(2,6-dimethylphenyl)-1,8-bis(trimethylsilyloxy)octane-4,5-diimine;dibromonickel (PubChem CID 24941636) has the molecular formula C30H48Br2N2NiO2Si2 and a molecular weight of 743.40 g/mol. Its IUPAC name is 4-N,5-N-bis(2,6-dimethylphenyl)-1,8-bis(trimethylsilyloxy)octane-4,5-diimine;dibromonickel.
| Compound Name | 4-N,5-N-bis(2,6-dimethylphenyl)-1,8-bis(trimethylsilyloxy)octane-4,5-diimine;dibromonickel |
|---|---|
| PubChem CID | 24941636 |
| Molecular Formula | C30H48Br2N2NiO2Si2 |
| Molecular Weight | 743.40 g/mol |
| Exact Mass | 740.10 |
| IUPAC Name | 4-N,5-N-bis(2,6-dimethylphenyl)-1,8-bis(trimethylsilyloxy)octane-4,5-diimine;dibromonickel |
| SMILES | Br[Ni]Br.Cc1cccc(C)c1/N=C(CCCO[Si](C)(C)C)/C(CCCO[Si](C)(C)C)=N/c1c(C)cccc1C |
| InChI | InChI=1S/C30H48N2O2Si2.2BrH.Ni/c1-23-15-11-16-24(2)29(23)31-27(19-13-21-33-35(5,6)7)28(20-14-22-34-36(8,9)10)32-30-25(3)17-12-18-26(30)4;;;/h11-12,15-18H,13-14,19-22H2,1-10H3;2*1H;/q;;;+2/p-2/b31-27+,32-28+;;; |
| InChIKey | CKLFWLGEYSZXKJ-RDHYOIAFSA-L |
| XLogP | 10.72 |
| TPSA | 43.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 743.40 |
| LogP ≤ 5 | 10.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|