C12H14Br2N4Ni — CID 18721431
dibromonickel;N-(2,6-dimethylphenyl)-1-(triazol-1-yl)ethanimine (PubChem CID 18721431) has the molecular formula C12H14Br2N4Ni and a molecular weight of 432.77 g/mol. Its IUPAC name is dibromonickel;N-(2,6-dimethylphenyl)-1-(triazol-1-yl)ethanimine.
| Compound Name | dibromonickel;N-(2,6-dimethylphenyl)-1-(triazol-1-yl)ethanimine |
|---|---|
| PubChem CID | 18721431 |
| Molecular Formula | C12H14Br2N4Ni |
| Molecular Weight | 432.77 g/mol |
| Exact Mass | 429.89 |
| IUPAC Name | dibromonickel;N-(2,6-dimethylphenyl)-1-(triazol-1-yl)ethanimine |
| SMILES | Br[Ni]Br.C/C(=N\c1c(C)cccc1C)n1ccnn1 |
| InChI | InChI=1S/C12H14N4.2BrH.Ni/c1-9-5-4-6-10(2)12(9)14-11(3)16-8-7-13-15-16;;;/h4-8H,1-3H3;2*1H;/q;;;+2/p-2/b14-11+;;; |
| InChIKey | PKIKNUKFZICWMR-UWCBQFGESA-L |
| XLogP | 4.18 |
| TPSA | 43.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.77 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|