C32H52N2O2Si2 — CID 21131778
5-N,6-N-bis(2,6-dimethylphenyl)-1,10-bis(trimethylsilyloxy)decane-5,6-diimine (PubChem CID 21131778) has the molecular formula C32H52N2O2Si2 and a molecular weight of 552.95 g/mol. Its IUPAC name is 5-N,6-N-bis(2,6-dimethylphenyl)-1,10-bis(trimethylsilyloxy)decane-5,6-diimine.
| Compound Name | 5-N,6-N-bis(2,6-dimethylphenyl)-1,10-bis(trimethylsilyloxy)decane-5,6-diimine |
|---|---|
| PubChem CID | 21131778 |
| Molecular Formula | C32H52N2O2Si2 |
| Molecular Weight | 552.95 g/mol |
| Exact Mass | 552.36 |
| IUPAC Name | 5-N,6-N-bis(2,6-dimethylphenyl)-1,10-bis(trimethylsilyloxy)decane-5,6-diimine |
| SMILES | Cc1cccc(C)c1/N=C(CCCCO[Si](C)(C)C)/C(CCCCO[Si](C)(C)C)=N/c1c(C)cccc1C |
| InChI | InChI=1S/C32H52N2O2Si2/c1-25-17-15-18-26(2)31(25)33-29(21-11-13-23-35-37(5,6)7)30(22-12-14-24-36-38(8,9)10)34-32-27(3)19-16-20-28(32)4/h15-20H,11-14,21-24H2,1-10H3/b33-29+,34-30+ |
| InChIKey | SJASSWSCRBOYMF-BNRZXNFUSA-N |
| XLogP | 9.81 |
| TPSA | 43.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.95 |
| LogP ≤ 5 | 9.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|