C32H52Br2N2NiO4Si2 — CID 21131751
4-N,5-N-bis(4-methoxy-2,6-dimethylphenyl)-1,8-bis(trimethylsilyloxy)octane-4,5-diimine;dibromonickel (PubChem CID 21131751) has the molecular formula C32H52Br2N2NiO4Si2 and a molecular weight of 803.45 g/mol. Its IUPAC name is 4-N,5-N-bis(4-methoxy-2,6-dimethylphenyl)-1,8-bis(trimethylsilyloxy)octane-4,5-diimine;dibromonickel.
| Compound Name | 4-N,5-N-bis(4-methoxy-2,6-dimethylphenyl)-1,8-bis(trimethylsilyloxy)octane-4,5-diimine;dibromonickel |
|---|---|
| PubChem CID | 21131751 |
| Molecular Formula | C32H52Br2N2NiO4Si2 |
| Molecular Weight | 803.45 g/mol |
| Exact Mass | 800.12 |
| IUPAC Name | 4-N,5-N-bis(4-methoxy-2,6-dimethylphenyl)-1,8-bis(trimethylsilyloxy)octane-4,5-diimine;dibromonickel |
| SMILES | Br[Ni]Br.COc1cc(C)c(/N=C(CCCO[Si](C)(C)C)/C(CCCO[Si](C)(C)C)=N/c2c(C)cc(OC)cc2C)c(C)c1 |
| InChI | InChI=1S/C32H52N2O4Si2.2BrH.Ni/c1-23-19-27(35-5)20-24(2)31(23)33-29(15-13-17-37-39(7,8)9)30(16-14-18-38-40(10,11)12)34-32-25(3)21-28(36-6)22-26(32)4;;;/h19-22H,13-18H2,1-12H3;2*1H;/q;;;+2/p-2/b33-29+,34-30+;;; |
| InChIKey | BKFDOEUIQIIVDD-OAMUHEOFSA-L |
| XLogP | 10.73 |
| TPSA | 61.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 803.45 |
| LogP ≤ 5 | 10.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|