C37H36Br2N2NiOSi — CID 21131707
2-N,3-N-di(anthracen-9-yl)-6-trimethylsilyloxyhexane-2,3-diimine;dibromonickel (PubChem CID 21131707) has the molecular formula C37H36Br2N2NiOSi and a molecular weight of 771.30 g/mol. Its IUPAC name is 2-N,3-N-di(anthracen-9-yl)-6-trimethylsilyloxyhexane-2,3-diimine;dibromonickel.
| Compound Name | 2-N,3-N-di(anthracen-9-yl)-6-trimethylsilyloxyhexane-2,3-diimine;dibromonickel |
|---|---|
| PubChem CID | 21131707 |
| Molecular Formula | C37H36Br2N2NiOSi |
| Molecular Weight | 771.30 g/mol |
| Exact Mass | 768.03 |
| IUPAC Name | 2-N,3-N-di(anthracen-9-yl)-6-trimethylsilyloxyhexane-2,3-diimine;dibromonickel |
| SMILES | Br[Ni]Br.CC(=N\c1c2ccccc2cc2ccccc12)/C(CCCO[Si](C)(C)C)=N/c1c2ccccc2cc2ccccc12 |
| InChI | InChI=1S/C37H36N2OSi.2BrH.Ni/c1-26(38-36-31-18-9-5-14-27(31)24-28-15-6-10-19-32(28)36)35(22-13-23-40-41(2,3)4)39-37-33-20-11-7-16-29(33)25-30-17-8-12-21-34(30)37;;;/h5-12,14-21,24-25H,13,22-23H2,1-4H3;2*1H;/q;;;+2/p-2/b38-26+,39-35+;;; |
| InChIKey | LDQHJCXJQMRMEI-FNBGLGLOSA-L |
| XLogP | 12.48 |
| TPSA | 33.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 771.30 |
| LogP ≤ 5 | 12.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|