C34H64O5Si2 — CID 139265829
methyl 6-[[(1R,3R)-3-[tert-butyl(dimethyl)silyl]oxy-2-[(E,3S)-3-[tert-butyl(dimethyl)silyl]oxyoct-1-enyl]-5-oxocyclopentyl]methyl]hept-6-enoate (PubChem CID 139265829) has the molecular formula C34H64O5Si2 and a molecular weight of 609.05 g/mol. Its IUPAC name is methyl 6-[[(1R,3R)-3-[tert-butyl(dimethyl)silyl]oxy-2-[(E,3S)-3-[tert-butyl(dimethyl)silyl]oxyoct-1-enyl]-5-oxocyclopentyl]methyl]hept-6-enoate.
| Compound Name | methyl 6-[[(1R,3R)-3-[tert-butyl(dimethyl)silyl]oxy-2-[(E,3S)-3-[tert-butyl(dimethyl)silyl]oxyoct-1-enyl]-5-oxocyclopentyl]methyl]hept-6-enoate |
|---|---|
| PubChem CID | 139265829 |
| Molecular Formula | C34H64O5Si2 |
| Molecular Weight | 609.05 g/mol |
| Exact Mass | 608.43 |
| IUPAC Name | methyl 6-[[(1R,3R)-3-[tert-butyl(dimethyl)silyl]oxy-2-[(E,3S)-3-[tert-butyl(dimethyl)silyl]oxyoct-1-enyl]-5-oxocyclopentyl]methyl]hept-6-enoate |
| SMILES | C=C(CCCCC(=O)OC)C[C@H]1C(=O)C[C@@H](O[Si](C)(C)C(C)(C)C)C1/C=C/[C@H](CCCCC)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C34H64O5Si2/c1-14-15-16-20-27(38-40(10,11)33(3,4)5)22-23-28-29(24-26(2)19-17-18-21-32(36)37-9)30(35)25-31(28)39-41(12,13)34(6,7)8/h22-23,27-29,31H,2,14-21,24-25H2,1,3-13H3/b23-22+/t27-,28?,29+,31+/m0/s1 |
| InChIKey | NIYCKWYRPJNDTH-FTPSLEOQSA-N |
| XLogP | 9.79 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.05 |
| LogP ≤ 5 | 9.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|