C24H27NO3Se2 — CID 139266032
ethyl (1S)-1-[bis(phenylselanyl)methyl]-2-cyano-4-methoxy-4-methylcyclopentane-1-carboxylate (PubChem CID 139266032) has the molecular formula C24H27NO3Se2 and a molecular weight of 535.40 g/mol. Its IUPAC name is ethyl (1S)-1-[bis(phenylselanyl)methyl]-2-cyano-4-methoxy-4-methylcyclopentane-1-carboxylate.
| Compound Name | ethyl (1S)-1-[bis(phenylselanyl)methyl]-2-cyano-4-methoxy-4-methylcyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 139266032 |
| Molecular Formula | C24H27NO3Se2 |
| Molecular Weight | 535.40 g/mol |
| Exact Mass | 537.03 |
| IUPAC Name | ethyl (1S)-1-[bis(phenylselanyl)methyl]-2-cyano-4-methoxy-4-methylcyclopentane-1-carboxylate |
| SMILES | CCOC(=O)[C@]1(C([Se]c2ccccc2)[Se]c2ccccc2)CC(C)(OC)CC1C#N |
| InChI | InChI=1S/C24H27NO3Se2/c1-4-28-21(26)24(17-23(2,27-3)15-18(24)16-25)22(29-19-11-7-5-8-12-19)30-20-13-9-6-10-14-20/h5-14,18,22H,4,15,17H2,1-3H3/t18?,23?,24-/m0/s1 |
| InChIKey | QWJVFQSDEFMFGX-WQMGSUCASA-N |
| XLogP | 2.68 |
| TPSA | 59.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.40 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|