C20H27NO4SeSi — CID 10766047
trans-diethyl (2R,3S)-2-cyano-3-[(R)-phenylselanyl(trimethylsilyl)methyl]cyclopropane-1,1-dicarboxylate (PubChem CID 10766047) has the molecular formula C20H27NO4SeSi and a molecular weight of 452.49 g/mol. Its IUPAC name is trans-diethyl (2R,3S)-2-cyano-3-[(R)-phenylselanyl(trimethylsilyl)methyl]cyclopropane-1,1-dicarboxylate.
| Compound Name | trans-diethyl (2R,3S)-2-cyano-3-[(R)-phenylselanyl(trimethylsilyl)methyl]cyclopropane-1,1-dicarboxylate |
|---|---|
| PubChem CID | 10766047 |
| Molecular Formula | C20H27NO4SeSi |
| Molecular Weight | 452.49 g/mol |
| Exact Mass | 453.09 |
| IUPAC Name | trans-diethyl (2R,3S)-2-cyano-3-[(R)-phenylselanyl(trimethylsilyl)methyl]cyclopropane-1,1-dicarboxylate |
| SMILES | CCOC(=O)C1(C(=O)OCC)[C@@H]([C@@H]([Se]c2ccccc2)[Si](C)(C)C)[C@H]1C#N |
| InChI | InChI=1S/C20H27NO4SeSi/c1-6-24-18(22)20(19(23)25-7-2)15(13-21)16(20)17(27(3,4)5)26-14-11-9-8-10-12-14/h8-12,15-17H,6-7H2,1-5H3/t15-,16-,17+/m1/s1 |
| InChIKey | YRPZPCVKHCKXCY-ZACQAIPSSA-N |
| XLogP | 2.56 |
| TPSA | 76.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.49 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|