C44H64O5SeSi — CID 10509451
cis-bis[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] (2R,3S)-2-(3-phenylpropanoyl)-3-[(S)-phenylselanyl(trimethylsilyl)methyl]cyclopropane-1,1-dicarboxylate (PubChem CID 10509451) has the molecular formula C44H64O5SeSi and a molecular weight of 780.04 g/mol. Its IUPAC name is cis-bis[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] (2R,3S)-2-(3-phenylpropanoyl)-3-[(S)-phenylselanyl(trimethylsilyl)methyl]cyclopropane-1,1-dicarboxylate.
| Compound Name | cis-bis[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] (2R,3S)-2-(3-phenylpropanoyl)-3-[(S)-phenylselanyl(trimethylsilyl)methyl]cyclopropane-1,1-dicarboxylate |
|---|---|
| PubChem CID | 10509451 |
| Molecular Formula | C44H64O5SeSi |
| Molecular Weight | 780.04 g/mol |
| Exact Mass | 780.37 |
| IUPAC Name | cis-bis[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] (2R,3S)-2-(3-phenylpropanoyl)-3-[(S)-phenylselanyl(trimethylsilyl)methyl]cyclopropane-1,1-dicarboxylate |
| SMILES | CC(C)[C@@H]1CC[C@@H](C)C[C@H]1OC(=O)C1(C(=O)O[C@@H]2C[C@H](C)CC[C@H]2C(C)C)[C@@H]([C@H]([Se]c2ccccc2)[Si](C)(C)C)[C@H]1C(=O)CCc1ccccc1 |
| InChI | InChI=1S/C44H64O5SeSi/c1-28(2)34-23-20-30(5)26-37(34)48-42(46)44(43(47)49-38-27-31(6)21-24-35(38)29(3)4)39(36(45)25-22-32-16-12-10-13-17-32)40(44)41(51(7,8)9)50-33-18-14-11-15-19-33/h10-19,28-31,34-35,37-41H,20-27H2,1-9H3/t30-,31-,34+,35+,37-,38-,39-,40-,41-/m1/s1 |
| InChIKey | BUWKIHYCXMDSCV-WRFLEEIGSA-N |
| XLogP | 9.12 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 780.04 |
| LogP ≤ 5 | 9.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|