C28H40O5 — CID 91332754
[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] 2-[(1R,2R,3R)-3-hydroxy-2-[(3S)-3-hydroxy-5-phenylpent-1-enyl]-5-oxocyclopentyl]acetate (PubChem CID 91332754) has the molecular formula C28H40O5 and a molecular weight of 456.62 g/mol. Its IUPAC name is [(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] 2-[(1R,2R,3R)-3-hydroxy-2-[(3S)-3-hydroxy-5-phenylpent-1-enyl]-5-oxocyclopentyl]acetate.
| Compound Name | [(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] 2-[(1R,2R,3R)-3-hydroxy-2-[(3S)-3-hydroxy-5-phenylpent-1-enyl]-5-oxocyclopentyl]acetate |
|---|---|
| PubChem CID | 91332754 |
| Molecular Formula | C28H40O5 |
| Molecular Weight | 456.62 g/mol |
| Exact Mass | 456.29 |
| IUPAC Name | [(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] 2-[(1R,2R,3R)-3-hydroxy-2-[(3S)-3-hydroxy-5-phenylpent-1-enyl]-5-oxocyclopentyl]acetate |
| SMILES | CC(C)[C@@H]1CC[C@@H](C)C[C@H]1OC(=O)C[C@H]1C(=O)C[C@@H](O)[C@@H]1C=C[C@@H](O)CCc1ccccc1 |
| InChI | InChI=1S/C28H40O5/c1-18(2)22-13-9-19(3)15-27(22)33-28(32)16-24-23(25(30)17-26(24)31)14-12-21(29)11-10-20-7-5-4-6-8-20/h4-8,12,14,18-19,21-25,27,29-30H,9-11,13,15-17H2,1-3H3/t19-,21+,22+,23-,24-,25-,27-/m1/s1 |
| InChIKey | BOJNECZYNUIPDO-POGVEJGQSA-N |
| XLogP | 4.50 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.62 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|