C20H19N3O4 — CID 139270311
ethyl 3-(5-methyl-1,3,4-oxadiazol-2-yl)-3-(6-phenylmethoxy-2-pyridinyl)prop-2-enoate (PubChem CID 139270311) has the molecular formula C20H19N3O4 and a molecular weight of 365.39 g/mol. Its IUPAC name is ethyl 3-(5-methyl-1,3,4-oxadiazol-2-yl)-3-(6-phenylmethoxy-2-pyridinyl)prop-2-enoate.
| Compound Name | ethyl 3-(5-methyl-1,3,4-oxadiazol-2-yl)-3-(6-phenylmethoxy-2-pyridinyl)prop-2-enoate |
|---|---|
| PubChem CID | 139270311 |
| Molecular Formula | C20H19N3O4 |
| Molecular Weight | 365.39 g/mol |
| Exact Mass | 365.14 |
| IUPAC Name | ethyl 3-(5-methyl-1,3,4-oxadiazol-2-yl)-3-(6-phenylmethoxy-2-pyridinyl)prop-2-enoate |
| SMILES | CCOC(=O)C=C(c1cccc(OCc2ccccc2)n1)c1nnc(C)o1 |
| InChI | InChI=1S/C20H19N3O4/c1-3-25-19(24)12-16(20-23-22-14(2)27-20)17-10-7-11-18(21-17)26-13-15-8-5-4-6-9-15/h4-12H,3,13H2,1-2H3 |
| InChIKey | YMWMBJVKEHTTSY-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 87.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.39 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|