C17H19NO6S — CID 156856327
ethyl 2-methylsulfonyloxy-2-(6-phenylmethoxy-2-pyridinyl)acetate (PubChem CID 156856327) has the molecular formula C17H19NO6S and a molecular weight of 365.41 g/mol. Its IUPAC name is ethyl 2-methylsulfonyloxy-2-(6-phenylmethoxy-2-pyridinyl)acetate.
| Compound Name | ethyl 2-methylsulfonyloxy-2-(6-phenylmethoxy-2-pyridinyl)acetate |
|---|---|
| PubChem CID | 156856327 |
| Molecular Formula | C17H19NO6S |
| Molecular Weight | 365.41 g/mol |
| Exact Mass | 365.09 |
| IUPAC Name | ethyl 2-methylsulfonyloxy-2-(6-phenylmethoxy-2-pyridinyl)acetate |
| SMILES | CCOC(=O)C(OS(C)(=O)=O)c1cccc(OCc2ccccc2)n1 |
| InChI | InChI=1S/C17H19NO6S/c1-3-22-17(19)16(24-25(2,20)21)14-10-7-11-15(18-14)23-12-13-8-5-4-6-9-13/h4-11,16H,3,12H2,1-2H3 |
| InChIKey | SLRSGTXLTLKZRF-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 91.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.41 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|