C26H31NO9S — CID 11620753
ethyl 2-[(Z)-[(3aR,6R,6aR)-2,2-dimethyl-6-phenylmethoxy-6,6a-dihydro-3aH-furo[2,3-d][1,3]dioxol-5-ylidene]methyl]-3-methylsulfonyloxy-3-pyridin-2-ylpropanoate (PubChem CID 11620753) has the molecular formula C26H31NO9S and a molecular weight of 533.60 g/mol. Its IUPAC name is ethyl 2-[(Z)-[(3aR,6R,6aR)-2,2-dimethyl-6-phenylmethoxy-6,6a-dihydro-3aH-furo[2,3-d][1,3]dioxol-5-ylidene]methyl]-3-methylsulfonyloxy-3-pyridin-2-ylpropanoate.
| Compound Name | ethyl 2-[(Z)-[(3aR,6R,6aR)-2,2-dimethyl-6-phenylmethoxy-6,6a-dihydro-3aH-furo[2,3-d][1,3]dioxol-5-ylidene]methyl]-3-methylsulfonyloxy-3-pyridin-2-ylpropanoate |
|---|---|
| PubChem CID | 11620753 |
| Molecular Formula | C26H31NO9S |
| Molecular Weight | 533.60 g/mol |
| Exact Mass | 533.17 |
| IUPAC Name | ethyl 2-[(Z)-[(3aR,6R,6aR)-2,2-dimethyl-6-phenylmethoxy-6,6a-dihydro-3aH-furo[2,3-d][1,3]dioxol-5-ylidene]methyl]-3-methylsulfonyloxy-3-pyridin-2-ylpropanoate |
| SMILES | CCOC(=O)C(/C=C1\O[C@@H]2OC(C)(C)O[C@@H]2[C@H]1OCc1ccccc1)C(OS(C)(=O)=O)c1ccccn1 |
| InChI | InChI=1S/C26H31NO9S/c1-5-31-24(28)18(21(36-37(4,29)30)19-13-9-10-14-27-19)15-20-22(32-16-17-11-7-6-8-12-17)23-25(33-20)35-26(2,3)34-23/h6-15,18,21-23,25H,5,16H2,1-4H3/b20-15-/t18?,21?,22-,23+,25+/m0/s1 |
| InChIKey | AGRQQFFSTGSIAQ-BLWPESKPSA-N |
| XLogP | 3.26 |
| TPSA | 119.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.60 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|