C25H27NO6 — CID 101401688
ethyl (Z)-2-[(Z)-[(3aR,6R,6aR)-2,2-dimethyl-6-phenylmethoxy-6,6a-dihydro-3aH-furo[2,3-d][1,3]dioxol-5-ylidene]methyl]-3-pyridin-3-ylprop-2-enoate (PubChem CID 101401688) has the molecular formula C25H27NO6 and a molecular weight of 437.49 g/mol. Its IUPAC name is ethyl (Z)-2-[(Z)-[(3aR,6R,6aR)-2,2-dimethyl-6-phenylmethoxy-6,6a-dihydro-3aH-furo[2,3-d][1,3]dioxol-5-ylidene]methyl]-3-pyridin-3-ylprop-2-enoate.
| Compound Name | ethyl (Z)-2-[(Z)-[(3aR,6R,6aR)-2,2-dimethyl-6-phenylmethoxy-6,6a-dihydro-3aH-furo[2,3-d][1,3]dioxol-5-ylidene]methyl]-3-pyridin-3-ylprop-2-enoate |
|---|---|
| PubChem CID | 101401688 |
| Molecular Formula | C25H27NO6 |
| Molecular Weight | 437.49 g/mol |
| Exact Mass | 437.18 |
| IUPAC Name | ethyl (Z)-2-[(Z)-[(3aR,6R,6aR)-2,2-dimethyl-6-phenylmethoxy-6,6a-dihydro-3aH-furo[2,3-d][1,3]dioxol-5-ylidene]methyl]-3-pyridin-3-ylprop-2-enoate |
| SMILES | CCOC(=O)C(=C\c1cccnc1)/C=C1\O[C@@H]2OC(C)(C)O[C@@H]2[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C25H27NO6/c1-4-28-23(27)19(13-18-11-8-12-26-15-18)14-20-21(29-16-17-9-6-5-7-10-17)22-24(30-20)32-25(2,3)31-22/h5-15,21-22,24H,4,16H2,1-3H3/b19-13-,20-14-/t21-,22+,24+/m0/s1 |
| InChIKey | LMTMBCCBBPHZMY-WIXWFVNISA-N |
| XLogP | 4.01 |
| TPSA | 76.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.49 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|