C15H14O6 — CID 139291584
1,8-dihydroxy-1,2-dimethoxy-2H-xanthen-9-one (PubChem CID 139291584) has the molecular formula C15H14O6 and a molecular weight of 290.27 g/mol. Its IUPAC name is 1,8-dihydroxy-1,2-dimethoxy-2H-xanthen-9-one.
| Compound Name | 1,8-dihydroxy-1,2-dimethoxy-2H-xanthen-9-one |
|---|---|
| PubChem CID | 139291584 |
| Molecular Formula | C15H14O6 |
| Molecular Weight | 290.27 g/mol |
| Exact Mass | 290.08 |
| IUPAC Name | 1,8-dihydroxy-1,2-dimethoxy-2H-xanthen-9-one |
| SMILES | COC1C=Cc2oc3cccc(O)c3c(=O)c2C1(O)OC |
| InChI | InChI=1S/C15H14O6/c1-19-11-7-6-10-13(15(11,18)20-2)14(17)12-8(16)4-3-5-9(12)21-10/h3-7,11,16,18H,1-2H3 |
| InChIKey | WGYPOXKUWYMYDY-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 89.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.27 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|