C18H14O7 — CID 163064083
2,18-dihydroxy-4-methoxy-7,9,13-trioxapentacyclo[10.8.0.03,10.04,8.014,19]icosa-1,3(10),11,14,16,18-hexaen-20-one (PubChem CID 163064083) has the molecular formula C18H14O7 and a molecular weight of 342.30 g/mol. Its IUPAC name is 2,18-dihydroxy-4-methoxy-7,9,13-trioxapentacyclo[10.8.0.03,10.04,8.014,19]icosa-1,3(10),11,14,16,18-hexaen-20-one.
| Compound Name | 2,18-dihydroxy-4-methoxy-7,9,13-trioxapentacyclo[10.8.0.03,10.04,8.014,19]icosa-1,3(10),11,14,16,18-hexaen-20-one |
|---|---|
| PubChem CID | 163064083 |
| Molecular Formula | C18H14O7 |
| Molecular Weight | 342.30 g/mol |
| Exact Mass | 342.07 |
| IUPAC Name | 2,18-dihydroxy-4-methoxy-7,9,13-trioxapentacyclo[10.8.0.03,10.04,8.014,19]icosa-1,3(10),11,14,16,18-hexaen-20-one |
| SMILES | COC12CCOC1Oc1cc3oc4cccc(O)c4c(=O)c3c(O)c12 |
| InChI | InChI=1S/C18H14O7/c1-22-18-5-6-23-17(18)25-11-7-10-13(16(21)14(11)18)15(20)12-8(19)3-2-4-9(12)24-10/h2-4,7,17,19,21H,5-6H2,1H3 |
| InChIKey | CGLZIQOPCPNPAV-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 98.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.30 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|