C18H27N7O2 — CID 139292967
N-cyclohexyl-2-(2-methylhydrazinyl)-4-morpholin-4-yl-5H-pyrrolo[3,2-d]pyrimidine-6-carboxamide (PubChem CID 139292967) has the molecular formula C18H27N7O2 and a molecular weight of 373.46 g/mol. Its IUPAC name is N-cyclohexyl-2-(2-methylhydrazinyl)-4-morpholin-4-yl-5H-pyrrolo[3,2-d]pyrimidine-6-carboxamide.
| Compound Name | N-cyclohexyl-2-(2-methylhydrazinyl)-4-morpholin-4-yl-5H-pyrrolo[3,2-d]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 139292967 |
| Molecular Formula | C18H27N7O2 |
| Molecular Weight | 373.46 g/mol |
| Exact Mass | 373.22 |
| IUPAC Name | N-cyclohexyl-2-(2-methylhydrazinyl)-4-morpholin-4-yl-5H-pyrrolo[3,2-d]pyrimidine-6-carboxamide |
| SMILES | CNNc1nc(N2CCOCC2)c2[nH]c(C(=O)NC3CCCCC3)cc2n1 |
| InChI | InChI=1S/C18H27N7O2/c1-19-24-18-22-13-11-14(17(26)20-12-5-3-2-4-6-12)21-15(13)16(23-18)25-7-9-27-10-8-25/h11-12,19,21H,2-10H2,1H3,(H,20,26)(H,22,23,24) |
| InChIKey | RWLZUERJWLSINB-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 107.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.46 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|