C17H25N7O2 — CID 139293306
N-cyclopentyl-2-(2-methylhydrazinyl)-4-morpholin-4-yl-5H-pyrrolo[3,2-d]pyrimidine-6-carboxamide (PubChem CID 139293306) has the molecular formula C17H25N7O2 and a molecular weight of 359.43 g/mol. Its IUPAC name is N-cyclopentyl-2-(2-methylhydrazinyl)-4-morpholin-4-yl-5H-pyrrolo[3,2-d]pyrimidine-6-carboxamide.
| Compound Name | N-cyclopentyl-2-(2-methylhydrazinyl)-4-morpholin-4-yl-5H-pyrrolo[3,2-d]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 139293306 |
| Molecular Formula | C17H25N7O2 |
| Molecular Weight | 359.43 g/mol |
| Exact Mass | 359.21 |
| IUPAC Name | N-cyclopentyl-2-(2-methylhydrazinyl)-4-morpholin-4-yl-5H-pyrrolo[3,2-d]pyrimidine-6-carboxamide |
| SMILES | CNNc1nc(N2CCOCC2)c2[nH]c(C(=O)NC3CCCC3)cc2n1 |
| InChI | InChI=1S/C17H25N7O2/c1-18-23-17-21-12-10-13(16(25)19-11-4-2-3-5-11)20-14(12)15(22-17)24-6-8-26-9-7-24/h10-11,18,20H,2-9H2,1H3,(H,19,25)(H,21,22,23) |
| InChIKey | QAYFEZUJFJQJDA-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 107.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.43 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|