C20H24F3N3OS — CID 139293660
(6R)-1-[2-(oxan-4-ylmethylamino)ethyl]-6-(2,3,6-trifluorophenyl)-2,5,6,7-tetrahydropyrrolo[1,2-c]imidazole-3-thione (PubChem CID 139293660) has the molecular formula C20H24F3N3OS and a molecular weight of 411.49 g/mol. Its IUPAC name is (6R)-1-[2-(oxan-4-ylmethylamino)ethyl]-6-(2,3,6-trifluorophenyl)-2,5,6,7-tetrahydropyrrolo[1,2-c]imidazole-3-thione.
| Compound Name | (6R)-1-[2-(oxan-4-ylmethylamino)ethyl]-6-(2,3,6-trifluorophenyl)-2,5,6,7-tetrahydropyrrolo[1,2-c]imidazole-3-thione |
|---|---|
| PubChem CID | 139293660 |
| Molecular Formula | C20H24F3N3OS |
| Molecular Weight | 411.49 g/mol |
| Exact Mass | 411.16 |
| IUPAC Name | (6R)-1-[2-(oxan-4-ylmethylamino)ethyl]-6-(2,3,6-trifluorophenyl)-2,5,6,7-tetrahydropyrrolo[1,2-c]imidazole-3-thione |
| SMILES | Fc1ccc(F)c([C@H]2Cc3c(CCNCC4CCOCC4)[nH]c(=S)n3C2)c1F |
| InChI | InChI=1S/C20H24F3N3OS/c21-14-1-2-15(22)19(23)18(14)13-9-17-16(25-20(28)26(17)11-13)3-6-24-10-12-4-7-27-8-5-12/h1-2,12-13,24H,3-11H2,(H,25,28)/t13-/m0/s1 |
| InChIKey | ZUJBXNBEMYVNOR-ZDUSSCGKSA-N |
| XLogP | 3.86 |
| TPSA | 41.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.49 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|