C19H18ClN3O3 — CID 139295389
N-(5-chloro-2-pyridinyl)-2-oxo-2-spiro[2H-1-benzofuran-3,4'-piperidine]-1'-ylacetamide (PubChem CID 139295389) has the molecular formula C19H18ClN3O3 and a molecular weight of 371.82 g/mol. Its IUPAC name is N-(5-chloro-2-pyridinyl)-2-oxo-2-spiro[2H-1-benzofuran-3,4'-piperidine]-1'-ylacetamide.
| Compound Name | N-(5-chloro-2-pyridinyl)-2-oxo-2-spiro[2H-1-benzofuran-3,4'-piperidine]-1'-ylacetamide |
|---|---|
| PubChem CID | 139295389 |
| Molecular Formula | C19H18ClN3O3 |
| Molecular Weight | 371.82 g/mol |
| Exact Mass | 371.10 |
| IUPAC Name | N-(5-chloro-2-pyridinyl)-2-oxo-2-spiro[2H-1-benzofuran-3,4'-piperidine]-1'-ylacetamide |
| SMILES | O=C(Nc1ccc(Cl)cn1)C(=O)N1CCC2(CC1)COc1ccccc12 |
| InChI | InChI=1S/C19H18ClN3O3/c20-13-5-6-16(21-11-13)22-17(24)18(25)23-9-7-19(8-10-23)12-26-15-4-2-1-3-14(15)19/h1-6,11H,7-10,12H2,(H,21,22,24) |
| InChIKey | FJFWKJSEROVQOM-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.82 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|