C19H30FN3O2 — CID 139298102
N-[4-[[1-(ethylamino)-3-methyl-1-oxopentan-3-yl]amino]butan-2-yl]-2-fluorobenzamide (PubChem CID 139298102) has the molecular formula C19H30FN3O2 and a molecular weight of 351.47 g/mol. Its IUPAC name is N-[4-[[1-(ethylamino)-3-methyl-1-oxopentan-3-yl]amino]butan-2-yl]-2-fluorobenzamide.
| Compound Name | N-[4-[[1-(ethylamino)-3-methyl-1-oxopentan-3-yl]amino]butan-2-yl]-2-fluorobenzamide |
|---|---|
| PubChem CID | 139298102 |
| Molecular Formula | C19H30FN3O2 |
| Molecular Weight | 351.47 g/mol |
| Exact Mass | 351.23 |
| IUPAC Name | N-[4-[[1-(ethylamino)-3-methyl-1-oxopentan-3-yl]amino]butan-2-yl]-2-fluorobenzamide |
| SMILES | CCNC(=O)CC(C)(CC)NCCC(C)NC(=O)c1ccccc1F |
| InChI | InChI=1S/C19H30FN3O2/c1-5-19(4,13-17(24)21-6-2)22-12-11-14(3)23-18(25)15-9-7-8-10-16(15)20/h7-10,14,22H,5-6,11-13H2,1-4H3,(H,21,24)(H,23,25) |
| InChIKey | UWTQMWIMCYMXLX-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.47 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |