C29H26N6 — CID 139299062
4-ethyl-15-(2-propan-2-yl-4,5-dihydro-3H-benzo[e]benzimidazol-7-yl)-3,5,8,10-tetrazatetracyclo[11.4.0.02,6.07,12]heptadeca-1(13),2(6),3,7,9,11,14,16-octaene (PubChem CID 139299062) has the molecular formula C29H26N6 and a molecular weight of 458.57 g/mol. Its IUPAC name is 4-ethyl-15-(2-propan-2-yl-4,5-dihydro-3H-benzo[e]benzimidazol-7-yl)-3,5,8,10-tetrazatetracyclo[11.4.0.02,6.07,12]heptadeca-1(13),2(6),3,7,9,11,14,16-octaene.
| Compound Name | 4-ethyl-15-(2-propan-2-yl-4,5-dihydro-3H-benzo[e]benzimidazol-7-yl)-3,5,8,10-tetrazatetracyclo[11.4.0.02,6.07,12]heptadeca-1(13),2(6),3,7,9,11,14,16-octaene |
|---|---|
| PubChem CID | 139299062 |
| Molecular Formula | C29H26N6 |
| Molecular Weight | 458.57 g/mol |
| Exact Mass | 458.22 |
| IUPAC Name | 4-ethyl-15-(2-propan-2-yl-4,5-dihydro-3H-benzo[e]benzimidazol-7-yl)-3,5,8,10-tetrazatetracyclo[11.4.0.02,6.07,12]heptadeca-1(13),2(6),3,7,9,11,14,16-octaene |
| SMILES | CCc1nc2c3ccc(-c4ccc5c(c4)CCc4[nH]c(C(C)C)nc4-5)cc3c3cncnc3c2[nH]1 |
| InChI | InChI=1S/C29H26N6/c1-4-24-33-27-20-9-6-17(12-21(20)22-13-30-14-31-26(22)28(27)34-24)16-5-8-19-18(11-16)7-10-23-25(19)35-29(32-23)15(2)3/h5-6,8-9,11-15H,4,7,10H2,1-3H3,(H,32,35)(H,33,34) |
| InChIKey | LNBPHSNTEXHXQC-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 83.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.57 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|