C34H40N6 — CID 143849149
acetylene;N-[[5-[4-[2-[(1R,3S,5R)-2-azabicyclo[3.1.0]hexan-3-yl]-4,5-dihydro-3H-benzo[e]benzimidazol-7-yl]phenyl]-1H-imidazol-2-yl]methyl]-2-methylcyclopropan-1-amine;ethane (PubChem CID 143849149) has the molecular formula C34H40N6 and a molecular weight of 532.74 g/mol. Its IUPAC name is acetylene;N-[[5-[4-[2-[(1R,3S,5R)-2-azabicyclo[3.1.0]hexan-3-yl]-4,5-dihydro-3H-benzo[e]benzimidazol-7-yl]phenyl]-1H-imidazol-2-yl]methyl]-2-methylcyclopropan-1-amine;ethane.
| Compound Name | acetylene;N-[[5-[4-[2-[(1R,3S,5R)-2-azabicyclo[3.1.0]hexan-3-yl]-4,5-dihydro-3H-benzo[e]benzimidazol-7-yl]phenyl]-1H-imidazol-2-yl]methyl]-2-methylcyclopropan-1-amine;ethane |
|---|---|
| PubChem CID | 143849149 |
| Molecular Formula | C34H40N6 |
| Molecular Weight | 532.74 g/mol |
| Exact Mass | 532.33 |
| IUPAC Name | acetylene;N-[[5-[4-[2-[(1R,3S,5R)-2-azabicyclo[3.1.0]hexan-3-yl]-4,5-dihydro-3H-benzo[e]benzimidazol-7-yl]phenyl]-1H-imidazol-2-yl]methyl]-2-methylcyclopropan-1-amine;ethane |
| SMILES | C#C.CC.CC1CC1NCc1ncc(-c2ccc(-c3ccc4c(c3)CCc3[nH]c([C@@H]5C[C@H]6C[C@H]6N5)nc3-4)cc2)[nH]1 |
| InChI | InChI=1S/C30H32N6.C2H6.C2H2/c1-16-10-24(16)31-15-28-32-14-27(34-28)18-4-2-17(3-5-18)19-6-8-22-20(11-19)7-9-23-29(22)36-30(35-23)26-13-21-12-25(21)33-26;2*1-2/h2-6,8,11,14,16,21,24-26,31,33H,7,9-10,12-13,15H2,1H3,(H,32,34)(H,35,36);1-2H3;1-2H/t16?,21-,24?,25-,26+;;/m1../s1 |
| InChIKey | BFVGRLQVIKBQNH-KHMFWTTHSA-N |
| XLogP | 6.43 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.74 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|