C24H31FN2O4 — CID 139305345
propan-2-yl (2R)-2-(4-amino-3-fluorophenyl)-4,4-dimethyl-2-(phenylmethoxycarbonylamino)pentanoate (PubChem CID 139305345) has the molecular formula C24H31FN2O4 and a molecular weight of 430.52 g/mol. Its IUPAC name is propan-2-yl (2R)-2-(4-amino-3-fluorophenyl)-4,4-dimethyl-2-(phenylmethoxycarbonylamino)pentanoate.
| Compound Name | propan-2-yl (2R)-2-(4-amino-3-fluorophenyl)-4,4-dimethyl-2-(phenylmethoxycarbonylamino)pentanoate |
|---|---|
| PubChem CID | 139305345 |
| Molecular Formula | C24H31FN2O4 |
| Molecular Weight | 430.52 g/mol |
| Exact Mass | 430.23 |
| IUPAC Name | propan-2-yl (2R)-2-(4-amino-3-fluorophenyl)-4,4-dimethyl-2-(phenylmethoxycarbonylamino)pentanoate |
| SMILES | CC(C)OC(=O)[C@](CC(C)(C)C)(NC(=O)OCc1ccccc1)c1ccc(N)c(F)c1 |
| InChI | InChI=1S/C24H31FN2O4/c1-16(2)31-21(28)24(15-23(3,4)5,18-11-12-20(26)19(25)13-18)27-22(29)30-14-17-9-7-6-8-10-17/h6-13,16H,14-15,26H2,1-5H3,(H,27,29)/t24-/m1/s1 |
| InChIKey | WMBSOTOSVQDRCH-XMMPIXPASA-N |
| XLogP | 4.92 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.52 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|