C10H11N — CID 139306317
2,4-dimethyl-3aH-indole (PubChem CID 139306317) has the molecular formula C10H11N and a molecular weight of 145.20 g/mol. Its IUPAC name is 2,4-dimethyl-3aH-indole.
| Compound Name | 2,4-dimethyl-3aH-indole |
|---|---|
| PubChem CID | 139306317 |
| Molecular Formula | C10H11N |
| Molecular Weight | 145.20 g/mol |
| Exact Mass | 145.09 |
| IUPAC Name | 2,4-dimethyl-3aH-indole |
| SMILES | CC1=CC2C(C)=CC=CC2=N1 |
| InChI | InChI=1S/C10H11N/c1-7-4-3-5-10-9(7)6-8(2)11-10/h3-6,9H,1-2H3 |
| InChIKey | WTYCDCRYWLJCAA-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 145.20 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |