About (6S)-2,5-dimethylbicyclo[4.1.0]hepta-1(7),2,4-triene
(6S)-2,5-dimethylbicyclo[4.1.0]hepta-1(7),2,4-triene (PubChem CID 163857189) has the molecular formula C9H10
and a molecular weight of 118.18 g/mol. Its IUPAC name is (6S)-2,5-dimethylbicyclo[4.1.0]hepta-1(7),2,4-triene.
Analyze (6S)-2,5-dimethylbicyclo[4.1.0]hepta-1(7),2,4-triene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6S)-2,5-dimethylbicyclo[4.1.0]hepta-1(7),2,4-triene?
The IUPAC name of (6S)-2,5-dimethylbicyclo[4.1.0]hepta-1(7),2,4-triene (CID 163857189) is (6S)-2,5-dimethylbicyclo[4.1.0]hepta-1(7),2,4-triene.
What is the SMILES notation for (6S)-2,5-dimethylbicyclo[4.1.0]hepta-1(7),2,4-triene?
The canonical SMILES for (6S)-2,5-dimethylbicyclo[4.1.0]hepta-1(7),2,4-triene is CC1=CC=C(C)[C@@H]2C=C12.
What is the InChIKey of (6S)-2,5-dimethylbicyclo[4.1.0]hepta-1(7),2,4-triene?
The InChIKey is OZHPMYCZBIAVFF-QMMMGPOBSA-N. The full InChI is InChI=1S/C9H10/c1-6-3-4-7(2)9-5-8(6)9/h3-5,8H,1-2H3/t8-/m0/s1.
What are the key properties of (6S)-2,5-dimethylbicyclo[4.1.0]hepta-1(7),2,4-triene?
(6S)-2,5-dimethylbicyclo[4.1.0]hepta-1(7),2,4-triene has a molecular weight of 118.18 g/mol, XLogP of 2.45, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (6S)-2,5-dimethylbicyclo[4.1.0]hepta-1(7),2,4-triene is sourced from PubChem (CID 163857189), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).