C8H8N2U — CID 23395156
(6-azanidylidene-2,5-dimethylcyclohexa-2,4-dien-1-ylidene)azanide;uranium(2+) (PubChem CID 23395156) has the molecular formula C8H8N2U and a molecular weight of 370.20 g/mol. Its IUPAC name is (6-azanidylidene-2,5-dimethylcyclohexa-2,4-dien-1-ylidene)azanide;uranium(2+).
| Compound Name | (6-azanidylidene-2,5-dimethylcyclohexa-2,4-dien-1-ylidene)azanide;uranium(2+) |
|---|---|
| PubChem CID | 23395156 |
| Molecular Formula | C8H8N2U |
| Molecular Weight | 370.20 g/mol |
| Exact Mass | 370.12 |
| IUPAC Name | (6-azanidylidene-2,5-dimethylcyclohexa-2,4-dien-1-ylidene)azanide;uranium(2+) |
| SMILES | CC1=CC=C(C)C(=[N-])C1=[N-].[U+2] |
| InChI | InChI=1S/C8H8N2.U/c1-5-3-4-6(2)8(10)7(5)9;/h3-4H,1-2H3;/q-2;+2 |
| InChIKey | MAQYBPRVJPBRIE-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 44.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.20 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'chinone_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|