C8H10OS — CID 18407699
6-hydroxy-2,5-dimethylcyclohexa-2,4-diene-1-thione (PubChem CID 18407699) has the molecular formula C8H10OS and a molecular weight of 154.23 g/mol. Its IUPAC name is 6-hydroxy-2,5-dimethylcyclohexa-2,4-diene-1-thione.
| Compound Name | 6-hydroxy-2,5-dimethylcyclohexa-2,4-diene-1-thione |
|---|---|
| PubChem CID | 18407699 |
| Molecular Formula | C8H10OS |
| Molecular Weight | 154.23 g/mol |
| Exact Mass | 154.05 |
| IUPAC Name | 6-hydroxy-2,5-dimethylcyclohexa-2,4-diene-1-thione |
| SMILES | CC1=CC=C(C)C(O)C1=S |
| InChI | InChI=1S/C8H10OS/c1-5-3-4-6(2)8(10)7(5)9/h3-4,7,9H,1-2H3 |
| InChIKey | NAIYHUZPXMDTKL-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.23 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|