C8H12O2 — CID 10219475
(1R,2S)-3,6-dimethylcyclohexa-3,5-diene-1,2-diol (PubChem CID 10219475) has the molecular formula C8H12O2 and a molecular weight of 140.18 g/mol. Its IUPAC name is (1R,2S)-3,6-dimethylcyclohexa-3,5-diene-1,2-diol.
| Compound Name | (1R,2S)-3,6-dimethylcyclohexa-3,5-diene-1,2-diol |
|---|---|
| PubChem CID | 10219475 |
| Molecular Formula | C8H12O2 |
| Molecular Weight | 140.18 g/mol |
| Exact Mass | 140.08 |
| IUPAC Name | (1R,2S)-3,6-dimethylcyclohexa-3,5-diene-1,2-diol |
| SMILES | CC1=CC=C(C)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C8H12O2/c1-5-3-4-6(2)8(10)7(5)9/h3-4,7-10H,1-2H3/t7-,8+ |
| InChIKey | SYNKFRQUBCHBOW-OCAPTIKFSA-N |
| XLogP | 0.61 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 140.18 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |