C8H11O3S- — CID 163563017
4,5-dimethylcyclohexa-1,3-diene-1-sulfonate (PubChem CID 163563017) has the molecular formula C8H11O3S- and a molecular weight of 187.24 g/mol. Its IUPAC name is 4,5-dimethylcyclohexa-1,3-diene-1-sulfonate.
| Compound Name | 4,5-dimethylcyclohexa-1,3-diene-1-sulfonate |
|---|---|
| PubChem CID | 163563017 |
| Molecular Formula | C8H11O3S- |
| Molecular Weight | 187.24 g/mol |
| Exact Mass | 187.04 |
| IUPAC Name | 4,5-dimethylcyclohexa-1,3-diene-1-sulfonate |
| SMILES | CC1=CC=C(S(=O)(=O)[O-])CC1C |
| InChI | InChI=1S/C8H12O3S/c1-6-3-4-8(5-7(6)2)12(9,10)11/h3-4,7H,5H2,1-2H3,(H,9,10,11)/p-1 |
| InChIKey | FSVYPALHPRTSFH-UHFFFAOYSA-M |
| XLogP | 1.40 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.24 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|