C14H22O3S — CID 143028089
(1E,3Z,6Z,8Z)-4,5-dimethylcyclodeca-1,3,6,8-tetraene-1-sulfonic acid;ethane (PubChem CID 143028089) has the molecular formula C14H22O3S and a molecular weight of 270.39 g/mol. Its IUPAC name is (1E,3Z,6Z,8Z)-4,5-dimethylcyclodeca-1,3,6,8-tetraene-1-sulfonic acid;ethane.
| Compound Name | (1E,3Z,6Z,8Z)-4,5-dimethylcyclodeca-1,3,6,8-tetraene-1-sulfonic acid;ethane |
|---|---|
| PubChem CID | 143028089 |
| Molecular Formula | C14H22O3S |
| Molecular Weight | 270.39 g/mol |
| Exact Mass | 270.13 |
| IUPAC Name | (1E,3Z,6Z,8Z)-4,5-dimethylcyclodeca-1,3,6,8-tetraene-1-sulfonic acid;ethane |
| SMILES | C/C1=C/C=C(/S(=O)(=O)O)C/C=C\C=C/C1C.CC |
| InChI | InChI=1S/C12H16O3S.C2H6/c1-10-6-4-3-5-7-12(16(13,14)15)9-8-11(10)2;1-2/h3-6,8-10H,7H2,1-2H3,(H,13,14,15);1-2H3/b5-3-,6-4-,11-8-,12-9+; |
| InChIKey | AFKBNSIOSHQDPG-SMSSXNFFSA-N |
| XLogP | 3.88 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.39 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|