About 4,5-dimethyl-1-methylsulfonylcyclohexa-1,3-diene
4,5-dimethyl-1-methylsulfonylcyclohexa-1,3-diene (PubChem CID 122541980) has the molecular formula C9H14O2S
and a molecular weight of 186.28 g/mol. Its IUPAC name is 4,5-dimethyl-1-methylsulfonylcyclohexa-1,3-diene.
Molecular Properties
| Compound Name | 4,5-dimethyl-1-methylsulfonylcyclohexa-1,3-diene |
| PubChem CID | 122541980 |
| Molecular Formula | C9H14O2S |
| Molecular Weight | 186.28 g/mol |
| Exact Mass | 186.07 |
| IUPAC Name | 4,5-dimethyl-1-methylsulfonylcyclohexa-1,3-diene |
| SMILES | CC1=CC=C(S(C)(=O)=O)CC1C |
| InChI | InChI=1S/C9H14O2S/c1-7-4-5-9(6-8(7)2)12(3,10)11/h4-5,8H,6H2,1-3H3 |
| InChIKey | LNULNTXTVHYYNV-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.28 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4,5-dimethyl-1-methylsulfonylcyclohexa-1,3-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5-dimethyl-1-methylsulfonylcyclohexa-1,3-diene?
The IUPAC name of 4,5-dimethyl-1-methylsulfonylcyclohexa-1,3-diene (CID 122541980) is 4,5-dimethyl-1-methylsulfonylcyclohexa-1,3-diene.
What is the SMILES notation for 4,5-dimethyl-1-methylsulfonylcyclohexa-1,3-diene?
The canonical SMILES for 4,5-dimethyl-1-methylsulfonylcyclohexa-1,3-diene is CC1=CC=C(S(C)(=O)=O)CC1C.
What is the InChIKey of 4,5-dimethyl-1-methylsulfonylcyclohexa-1,3-diene?
The InChIKey is LNULNTXTVHYYNV-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14O2S/c1-7-4-5-9(6-8(7)2)12(3,10)11/h4-5,8H,6H2,1-3H3.
What are the key properties of 4,5-dimethyl-1-methylsulfonylcyclohexa-1,3-diene?
4,5-dimethyl-1-methylsulfonylcyclohexa-1,3-diene has a molecular weight of 186.28 g/mol, XLogP of 1.90, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-dimethyl-1-methylsulfonylcyclohexa-1,3-diene is sourced from PubChem (CID 122541980), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).