About azanium 4H-benzotriazole-5-sulfonate
azanium 4H-benzotriazole-5-sulfonate (PubChem CID 87932721) has the molecular formula C6H8N4O3S
and a molecular weight of 216.22 g/mol. Its IUPAC name is azanium 4H-benzotriazole-5-sulfonate.
Molecular Properties
| Compound Name | azanium 4H-benzotriazole-5-sulfonate |
| PubChem CID | 87932721 |
| Molecular Formula | C6H8N4O3S |
| Molecular Weight | 216.22 g/mol |
| Exact Mass | 216.03 |
| IUPAC Name | azanium 4H-benzotriazole-5-sulfonate |
| SMILES | O=S(=O)([O-])C1=CC=C2N=NN=C2C1.[NH4+] |
| InChI | InChI=1S/C6H5N3O3S.H3N/c10-13(11,12)4-1-2-5-6(3-4)8-9-7-5;/h1-2H,3H2,(H,10,11,12);1H3 |
| InChIKey | BJTGEAVOKRMOOK-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 130.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.22 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze azanium 4H-benzotriazole-5-sulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azanium 4H-benzotriazole-5-sulfonate?
The IUPAC name of azanium 4H-benzotriazole-5-sulfonate (CID 87932721) is azanium 4H-benzotriazole-5-sulfonate.
What is the SMILES notation for azanium 4H-benzotriazole-5-sulfonate?
The canonical SMILES for azanium 4H-benzotriazole-5-sulfonate is O=S(=O)([O-])C1=CC=C2N=NN=C2C1.[NH4+].
What is the InChIKey of azanium 4H-benzotriazole-5-sulfonate?
The InChIKey is BJTGEAVOKRMOOK-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5N3O3S.H3N/c10-13(11,12)4-1-2-5-6(3-4)8-9-7-5;/h1-2H,3H2,(H,10,11,12);1H3.
What are the key properties of azanium 4H-benzotriazole-5-sulfonate?
azanium 4H-benzotriazole-5-sulfonate has a molecular weight of 216.22 g/mol, XLogP of 0.90, 1 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for azanium 4H-benzotriazole-5-sulfonate is sourced from PubChem (CID 87932721), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).