C7H5N2NaO3S2 — CID 101243428
sodium 6-sulfanyl-1H-benzimidazole-2-sulfonate (PubChem CID 101243428) has the molecular formula C7H5N2NaO3S2 and a molecular weight of 252.25 g/mol. Its IUPAC name is sodium 6-sulfanyl-1H-benzimidazole-2-sulfonate.
| Compound Name | sodium 6-sulfanyl-1H-benzimidazole-2-sulfonate |
|---|---|
| PubChem CID | 101243428 |
| Molecular Formula | C7H5N2NaO3S2 |
| Molecular Weight | 252.25 g/mol |
| Exact Mass | 251.96 |
| IUPAC Name | sodium 6-sulfanyl-1H-benzimidazole-2-sulfonate |
| SMILES | O=S(=O)([O-])c1nc2ccc(S)cc2[nH]1.[Na+] |
| InChI | InChI=1S/C7H6N2O3S2.Na/c10-14(11,12)7-8-5-2-1-4(13)3-6(5)9-7;/h1-3,13H,(H,8,9)(H,10,11,12);/q;+1/p-1 |
| InChIKey | MLPJHVOJXNLUER-UHFFFAOYSA-M |
| XLogP | -2.24 |
| TPSA | 85.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.25 |
| LogP ≤ 5 | -2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|