About (5S)-1-fluoro-4,5-dimethylcyclopenta-1,3-diene
(5S)-1-fluoro-4,5-dimethylcyclopenta-1,3-diene (PubChem CID 163495167) has the molecular formula C7H9F
and a molecular weight of 112.15 g/mol. Its IUPAC name is (5S)-1-fluoro-4,5-dimethylcyclopenta-1,3-diene.
Analyze (5S)-1-fluoro-4,5-dimethylcyclopenta-1,3-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5S)-1-fluoro-4,5-dimethylcyclopenta-1,3-diene?
The IUPAC name of (5S)-1-fluoro-4,5-dimethylcyclopenta-1,3-diene (CID 163495167) is (5S)-1-fluoro-4,5-dimethylcyclopenta-1,3-diene.
What is the SMILES notation for (5S)-1-fluoro-4,5-dimethylcyclopenta-1,3-diene?
The canonical SMILES for (5S)-1-fluoro-4,5-dimethylcyclopenta-1,3-diene is CC1=CC=C(F)[C@H]1C.
What is the InChIKey of (5S)-1-fluoro-4,5-dimethylcyclopenta-1,3-diene?
The InChIKey is CQBKBEYZUHZJDG-LURJTMIESA-N. The full InChI is InChI=1S/C7H9F/c1-5-3-4-7(8)6(5)2/h3-4,6H,1-2H3/t6-/m0/s1.
What are the key properties of (5S)-1-fluoro-4,5-dimethylcyclopenta-1,3-diene?
(5S)-1-fluoro-4,5-dimethylcyclopenta-1,3-diene has a molecular weight of 112.15 g/mol, XLogP of 2.44, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (5S)-1-fluoro-4,5-dimethylcyclopenta-1,3-diene is sourced from PubChem (CID 163495167), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).