About ethane;1-fluoro-5,7-dimethylcyclohepta-1,3,5-triene
ethane;1-fluoro-5,7-dimethylcyclohepta-1,3,5-triene (PubChem CID 142113281) has the molecular formula C11H17F
and a molecular weight of 168.25 g/mol. Its IUPAC name is ethane;1-fluoro-5,7-dimethylcyclohepta-1,3,5-triene.
Analyze ethane;1-fluoro-5,7-dimethylcyclohepta-1,3,5-triene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;1-fluoro-5,7-dimethylcyclohepta-1,3,5-triene?
The IUPAC name of ethane;1-fluoro-5,7-dimethylcyclohepta-1,3,5-triene (CID 142113281) is ethane;1-fluoro-5,7-dimethylcyclohepta-1,3,5-triene.
What is the SMILES notation for ethane;1-fluoro-5,7-dimethylcyclohepta-1,3,5-triene?
The canonical SMILES for ethane;1-fluoro-5,7-dimethylcyclohepta-1,3,5-triene is CC.CC1=CC(C)C(F)=CC=C1.
What is the InChIKey of ethane;1-fluoro-5,7-dimethylcyclohepta-1,3,5-triene?
The InChIKey is KNYSCMLKRFFPDX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11F.C2H6/c1-7-4-3-5-9(10)8(2)6-7;1-2/h3-6,8H,1-2H3;1-2H3.
What are the key properties of ethane;1-fluoro-5,7-dimethylcyclohepta-1,3,5-triene?
ethane;1-fluoro-5,7-dimethylcyclohepta-1,3,5-triene has a molecular weight of 168.25 g/mol, XLogP of 4.02, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;1-fluoro-5,7-dimethylcyclohepta-1,3,5-triene is sourced from PubChem (CID 142113281), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).