C9H20N4 — CID 139308243
(4Z)-5-hydrazinyl-8-methylcyclooct-4-ene-1,4-diamine (PubChem CID 139308243) has the molecular formula C9H20N4 and a molecular weight of 184.29 g/mol. Its IUPAC name is (4Z)-5-hydrazinyl-8-methylcyclooct-4-ene-1,4-diamine.
| Compound Name | (4Z)-5-hydrazinyl-8-methylcyclooct-4-ene-1,4-diamine |
|---|---|
| PubChem CID | 139308243 |
| Molecular Formula | C9H20N4 |
| Molecular Weight | 184.29 g/mol |
| Exact Mass | 184.17 |
| IUPAC Name | (4Z)-5-hydrazinyl-8-methylcyclooct-4-ene-1,4-diamine |
| SMILES | CC1CC/C(NN)=C(/N)CCC1N |
| InChI | InChI=1S/C9H20N4/c1-6-2-5-9(13-12)8(11)4-3-7(6)10/h6-7,13H,2-5,10-12H2,1H3/b9-8- |
| InChIKey | RZWYJYBEYIRFCX-HJWRWDBZSA-N |
| XLogP | 0.16 |
| TPSA | 90.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.29 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|