C10H20N4 — CID 163855401
1-(3-diazenyl-2,4,6-trimethylcyclohex-2-en-1-yl)-2-methylhydrazine (PubChem CID 163855401) has the molecular formula C10H20N4 and a molecular weight of 196.30 g/mol. Its IUPAC name is 1-(3-diazenyl-2,4,6-trimethylcyclohex-2-en-1-yl)-2-methylhydrazine.
| Compound Name | 1-(3-diazenyl-2,4,6-trimethylcyclohex-2-en-1-yl)-2-methylhydrazine |
|---|---|
| PubChem CID | 163855401 |
| Molecular Formula | C10H20N4 |
| Molecular Weight | 196.30 g/mol |
| Exact Mass | 196.17 |
| IUPAC Name | 1-(3-diazenyl-2,4,6-trimethylcyclohex-2-en-1-yl)-2-methylhydrazine |
| SMILES | [H]/N=N/C1=C(C)C(NNC)C(C)CC1C |
| InChI | InChI=1S/C10H20N4/c1-6-5-7(2)10(14-12-4)8(3)9(6)13-11/h6-7,10-12,14H,5H2,1-4H3/b13-11+ |
| InChIKey | OXVRTOKNECUBJZ-ACCUITESSA-N |
| XLogP | 2.06 |
| TPSA | 60.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.30 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|