C18H28N2O2 — CID 139311784
(2R)-2-(2,2-dimethylpentyl)-1-[(4-nitrophenyl)methyl]pyrrolidine (PubChem CID 139311784) has the molecular formula C18H28N2O2 and a molecular weight of 304.43 g/mol. Its IUPAC name is (2R)-2-(2,2-dimethylpentyl)-1-[(4-nitrophenyl)methyl]pyrrolidine.
| Compound Name | (2R)-2-(2,2-dimethylpentyl)-1-[(4-nitrophenyl)methyl]pyrrolidine |
|---|---|
| PubChem CID | 139311784 |
| Molecular Formula | C18H28N2O2 |
| Molecular Weight | 304.43 g/mol |
| Exact Mass | 304.22 |
| IUPAC Name | (2R)-2-(2,2-dimethylpentyl)-1-[(4-nitrophenyl)methyl]pyrrolidine |
| SMILES | CCCC(C)(C)C[C@H]1CCCN1Cc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C18H28N2O2/c1-4-11-18(2,3)13-17-6-5-12-19(17)14-15-7-9-16(10-8-15)20(21)22/h7-10,17H,4-6,11-14H2,1-3H3/t17-/m1/s1 |
| InChIKey | OSQCKYVSCMMPRH-QGZVFWFLSA-N |
| XLogP | 4.78 |
| TPSA | 46.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.43 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|