C21H35N3O4 — CID 159503747
2-[1-[(4-nitrophenyl)methyl]pyrrolidin-2-yl]propan-2-ol;2-pyrrolidin-2-ylpropan-2-ol (PubChem CID 159503747) has the molecular formula C21H35N3O4 and a molecular weight of 393.53 g/mol. Its IUPAC name is 2-[1-[(4-nitrophenyl)methyl]pyrrolidin-2-yl]propan-2-ol;2-pyrrolidin-2-ylpropan-2-ol.
| Compound Name | 2-[1-[(4-nitrophenyl)methyl]pyrrolidin-2-yl]propan-2-ol;2-pyrrolidin-2-ylpropan-2-ol |
|---|---|
| PubChem CID | 159503747 |
| Molecular Formula | C21H35N3O4 |
| Molecular Weight | 393.53 g/mol |
| Exact Mass | 393.26 |
| IUPAC Name | 2-[1-[(4-nitrophenyl)methyl]pyrrolidin-2-yl]propan-2-ol;2-pyrrolidin-2-ylpropan-2-ol |
| SMILES | CC(C)(O)C1CCCN1.CC(C)(O)C1CCCN1Cc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C14H20N2O3.C7H15NO/c1-14(2,17)13-4-3-9-15(13)10-11-5-7-12(8-6-11)16(18)19;1-7(2,9)6-4-3-5-8-6/h5-8,13,17H,3-4,9-10H2,1-2H3;6,8-9H,3-5H2,1-2H3 |
| InChIKey | LZSJCGHTRWOCCO-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 98.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.53 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|